CAS 1083181-47-8

6-Bromo-3-chloro-2-quinoxalinamine

Description:

6-Bromo-3-chloro-2-quinoxalinamine is a chemical compound characterized by its unique structure, which includes a quinoxaline core substituted with bromine and chlorine atoms. This compound typically exhibits properties associated with heterocyclic amines, including potential biological activity due to the presence of halogen substituents that can influence reactivity and interaction with biological targets. The presence of both bromine and chlorine can enhance lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, quinoxaline derivatives are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The compound's molecular structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, making it of interest in synthetic organic chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds. Overall, 6-Bromo-3-chloro-2-quinoxalinamine represents a class of compounds with significant implications in medicinal chemistry and material science.

Formula: C₈H₅BrClN₃

InChI: InChI=1S/C8H5BrClN3/c9-4-1-2-5-6(3-4)12-7(10)8(11)13-5/h1-3H,(H2,11,13)

InChI key: InChIKey=OHECRYPLGOMEBE-UHFFFAOYSA-N

SMILES: ClC1=NC2=C(N=C1N)C=CC(Br)=C2

Synonyms:

• 6-Bromo-3-chloro-2-quinoxalinamine
• 2-Quinoxalinamine, 6-bromo-3-chloro-