CAS 1083181-48-9
:3-Amino-6-bromo-2(1H)-quinoxalinone
Description:
3-Amino-6-bromo-2(1H)-quinoxalinone is a heterocyclic organic compound characterized by the presence of a quinoxaline core, which is a bicyclic structure containing two nitrogen atoms. This compound features an amino group (-NH2) and a bromo substituent (-Br) at specific positions on the quinoxaline ring, contributing to its reactivity and potential biological activity. The presence of the amino group can enhance its solubility in polar solvents and may facilitate interactions with biological targets, making it of interest in medicinal chemistry. The bromine atom introduces additional electrophilic characteristics, which can be exploited in various chemical reactions, including substitution and coupling reactions. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be necessary to confirm these effects. Its unique structure and functional groups make it a valuable candidate for further research in drug development and synthetic chemistry.
Formula:C8H6BrN3O
InChI:InChI=1S/C8H6BrN3O/c9-4-1-2-5-6(3-4)11-7(10)8(13)12-5/h1-3H,(H2,10,11)(H,12,13)
InChI key:InChIKey=SKQGEJRUPBWRCX-UHFFFAOYSA-N
SMILES:NC1=NC=2C(NC1=O)=CC=C(Br)C2
Synonyms:- 3-Amino-6-bromo-2(1H)-quinoxalinone
- 2(1H)-Quinoxalinone, 3-amino-6-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
