CAS 1083196-25-1

Methyl pyrrolo[1,2-a]pyrimidine-6-carboxylate

Description:

Methyl pyrrolo[1,2-a]pyrimidine-6-carboxylate is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyrimidine ring. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various synthetic processes. Methyl pyrrolo[1,2-a]pyrimidine-6-carboxylate is of interest in pharmaceutical research due to its potential biological activities, which may include anti-inflammatory or anticancer properties. Its molecular structure allows for various modifications, which can lead to the development of derivatives with enhanced efficacy or selectivity. The compound's stability and reactivity can be influenced by factors such as pH and temperature, making it essential to consider these conditions during handling and experimentation. Overall, this compound represents a valuable scaffold in the development of new therapeutic agents.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-13-9(12)7-3-4-8-10-5-2-6-11(7)8/h2-6H,1H3

InChI key: InChIKey=PMBHAEZBHDXUKB-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N2C(=CC1)N=CC=C2

Synonyms:

• Methyl pyrrolo[1,2-a]pyrimidine-6-carboxylate
• Pyrrolo[1,2-a]pyrimidine-6-carboxylic acid, methyl ester