CAS 108321-15-9

phenolphthalein monophosphate disodium

Description:

Phenolphthalein monophosphate disodium, with the CAS number 108321-15-9, is a chemical compound that serves primarily as a pH indicator and a biochemical reagent. It is a derivative of phenolphthalein, which is known for its ability to change color in response to pH variations, typically transitioning from colorless in acidic solutions to pink in alkaline conditions. This compound is characterized by its solubility in water, making it suitable for various laboratory applications, particularly in biochemical assays and titrations. The disodium salt form enhances its solubility and stability in aqueous environments. Additionally, phenolphthalein monophosphate disodium is often utilized in studies involving enzyme activity, as it can act as a substrate for certain phosphatases. Its properties make it valuable in both educational and research settings, where precise pH monitoring and biochemical reactions are essential. As with any chemical, proper handling and safety precautions should be observed to mitigate any potential hazards associated with its use.

Formula: C₂₀H₁₃Na₂O₇P

InChI: InChI=1/C20H15O7P.2Na/c21-15-9-5-13(6-10-15)20(18-4-2-1-3-17(18)19(22)26-20)14-7-11-16(12-8-14)27-28(23,24)25;;/h1-12,21H,(H2,23,24,25);;/q;2*+1/p-2

SMILES: c1ccc2c(c1)C(=O)OC2(c1ccc(cc1)O)c1ccc(cc1)OP(=O)(O)O.[Na].[Na]

Synonyms:

• Disodium 4-[1-(4-Hydroxyphenyl)-3-Oxo-1,3-Dihydro-2-Benzofuran-1-Yl]Phenyl Phosphate