CAS 108322-11-8
:tyr-tyr-phe acetate
Description:
Tyr-tyr-phe acetate, also known as a peptide, is a synthetic compound composed of the amino acids tyrosine (Tyr) and phenylalanine (Phe) linked together in a specific sequence. This compound is characterized by its structural properties, which include the presence of aromatic side chains due to the tyrosine and phenylalanine residues, contributing to its hydrophobic characteristics. The acetate group indicates that the compound is likely in its acetate salt form, which can influence its solubility and stability in various solvents. Peptides like tyr-tyr-phe acetate are often studied for their biological activity, including potential roles in signaling pathways or as precursors to neurotransmitters. Additionally, the presence of multiple tyrosine residues may suggest potential for interactions with receptors or enzymes, making it of interest in pharmacological research. Overall, the characteristics of this compound make it a subject of interest in both biochemical and medicinal chemistry fields.
Formula:C27H29N3O6
InChI:InChI=1/C27H29N3O6/c28-22(14-18-6-10-20(31)11-7-18)25(33)29-23(15-19-8-12-21(32)13-9-19)26(34)30-24(27(35)36)16-17-4-2-1-3-5-17/h1-13,22-24,31-32H,14-16,28H2,(H,29,33)(H,30,34)(H,35,36)
SMILES:c1ccc(cc1)CC(C(=O)O)N=C(C(Cc1ccc(cc1)O)N=C(C(Cc1ccc(cc1)O)N)O)O
Synonyms:- Tyrosyl-tyrosyl-phenylalanine
- Tyr-tyr-phe
- L-Phenylalanine, N-(N-L-tyrosyl-L-tyrosyl)-
- L-tyrosyl-L-tyrosyl-L-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
H-Tyr-Tyr-Phe-OH acetate salt
CAS:<p>H-Tyr-Tyr-Phe-OH acetate salt is a reaction product of the matrix-assisted laser desorption ionization (MALDI) technique. It is an analog of tyrosine, with a hydroxyl group substituted for the amino group. The protonation state of this molecule has been determined by the hydration constant and the centroid to be a neutral pH. Using hydrogen bonding, H-Tyr-Tyr-Phe-OH acetate salt binds to the mitochondria in cells, which may lead to a higher rate of reaction.</p>Formula:C27H29N3O6Purity:Min. 95%Molecular weight:491.54 g/mol
