
CAS 108322-27-6
:1-Azaspiro[4.5]decane-1-propanol
Description:
1-Azaspiro[4.5]decane-1-propanol, identified by its CAS number 108322-27-6, is a chemical compound characterized by its unique spirocyclic structure, which features a nitrogen atom integrated into a bicyclic framework. This compound typically exhibits properties associated with both amines and alcohols due to the presence of the azaspiro moiety and the hydroxyl (-OH) group. The spiro structure contributes to its rigidity and potential for specific stereochemical configurations, which can influence its reactivity and interactions with biological systems. It may exhibit moderate solubility in polar solvents, and its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the nitrogen atom may also impart basicity, allowing for interactions with various biological targets. Overall, 1-Azaspiro[4.5]decane-1-propanol represents a compound of interest for further research in organic synthesis and drug development due to its distinctive structural features and functional properties.
Formula:C12H23NO
InChI:InChI=1S/C12H23NO/c14-11-5-10-13-9-4-8-12(13)6-2-1-3-7-12/h14H,1-11H2
InChI key:InChIKey=JTNKNCMMVWEZKE-UHFFFAOYSA-N
SMILES:C(CCO)N1C2(CCC1)CCCCC2
Synonyms:- 3-[1-Azaspiro[4.5]decan-1-yl]propan-1-ol
- 1-Azaspiro[4.5]decane-1-propanol
- NSC 48799
- 3-(1-Aza-spiro[4.5]dec-1-yl)-propan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.