CAS 1083246-11-0

2-[(1-Methyl-2-piperidinyl)methoxy]acetic acid

Description:

2-[(1-Methyl-2-piperidinyl)methoxy]acetic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a methoxy group attached to an acetic acid moiety. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and alcohols due to the presence of the carboxylic acid functional group. The piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in various pharmaceuticals. The compound may also display moderate to high lipophilicity, influencing its absorption and distribution in biological systems. Its molecular interactions can be significant in drug design, particularly in targeting specific receptors or enzymes. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, 2-[(1-Methyl-2-piperidinyl)methoxy]acetic acid represents a compound of interest in medicinal chemistry and pharmacology.

Formula: C₉H₁₇NO₃

InChI: InChI=1S/C9H17NO3/c1-10-5-3-2-4-8(10)6-13-7-9(11)12/h8H,2-7H2,1H3,(H,11,12)

InChI key: InChIKey=SDRRESHOLYVGFP-UHFFFAOYSA-N

SMILES: C(OCC(O)=O)C1N(C)CCCC1

Synonyms:

• Acetic acid, 2-[(1-methyl-2-piperidinyl)methoxy]-
• 2-[(1-Methyl-2-piperidinyl)methoxy]acetic acid