CAS 1083273-83-9

α-Methyl-5-quinolinemethanamine

Description:

α-Methyl-5-quinolinemethanamine, identified by its CAS number 1083273-83-9, is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. This compound features an amino group (-NH2) attached to a methylene bridge (-CH2-) that connects to the quinoline moiety, along with a methyl group at the alpha position relative to the amino group. The presence of the methyl group can influence the compound's solubility, reactivity, and biological activity. α-Methyl-5-quinolinemethanamine may exhibit properties typical of amines, such as basicity and the ability to form salts with acids. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoline derivatives are known for various biological activities, including antimicrobial and antimalarial properties. However, specific data on its physical properties, such as melting point, boiling point, and solubility, would require further investigation or reference to specialized chemical databases.

Formula: C₁₁H₁₂N₂

InChI: InChI=1S/C11H12N2/c1-8(12)9-4-2-6-11-10(9)5-3-7-13-11/h2-8H,12H2,1H3

InChI key: InChIKey=ZLEHAUWQPBCLBY-UHFFFAOYSA-N

SMILES: C(C)(N)C=1C2=C(C=CC1)N=CC=C2

Synonyms:

• 1-(Quinolin-5-yl)ethan-1-amine
• 5-Quinolinemethanamine, α-methyl-
• α-Methyl-5-quinolinemethanamine
• 1-(Quinolin-5-yl)ethanamine