CymitQuimica logo

CAS 1083274-38-7

:

1,5-Dimethyl-1H-1,2,4-triazole-3-carboxaldehyde

Description:
1,5-Dimethyl-1H-1,2,4-triazole-3-carboxaldehyde is a heterocyclic organic compound characterized by its triazole ring structure, which contains nitrogen atoms that contribute to its unique chemical properties. This compound features two methyl groups at the 1 and 5 positions of the triazole ring, enhancing its lipophilicity and potentially influencing its biological activity. The presence of a carboxaldehyde functional group at the 3 position introduces reactivity, allowing for various chemical transformations, such as condensation reactions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and industry. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Overall, 1,5-Dimethyl-1H-1,2,4-triazole-3-carboxaldehyde is a versatile compound with significant implications in chemical synthesis and biological research.
Formula:C5H7N3O
InChI:InChI=1S/C5H7N3O/c1-4-6-5(3-9)7-8(4)2/h3H,1-2H3
InChI key:InChIKey=AGKOXOJEFOCGCX-UHFFFAOYSA-N
SMILES:C(=O)C=1N=C(C)N(C)N1
Synonyms:
  • 1H-1,2,4-Triazole-3-carboxaldehyde, 1,5-dimethyl-
  • 1,5-Dimethyl-1H-1,2,4-triazole-3-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.