CAS 1083326-19-5
:N-(5-Bromo-3-pyridinyl)cyclopropanesulfonamide
Description:
N-(5-Bromo-3-pyridinyl)cyclopropanesulfonamide is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a sulfonamide functional group. The presence of the bromine atom at the 5-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound is typically used in medicinal chemistry and may exhibit properties such as antibacterial or antitumor activity, although specific biological effects would depend on further studies. The sulfonamide group is known for its ability to form hydrogen bonds, which can influence the compound's solubility and interaction with biological targets. Additionally, the pyridine moiety can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry. Its molecular weight, solubility, and stability under different conditions would be important factors to consider in practical applications. Overall, N-(5-Bromo-3-pyridinyl)cyclopropanesulfonamide represents a versatile structure with potential implications in drug development and chemical research.
Formula:C8H9BrN2O2S
InChI:InChI=1S/C8H9BrN2O2S/c9-6-3-7(5-10-4-6)11-14(12,13)8-1-2-8/h3-5,8,11H,1-2H2
InChI key:InChIKey=XOUPUFNVVWWHER-UHFFFAOYSA-N
SMILES:S(NC=1C=C(Br)C=NC1)(=O)(=O)C2CC2
Synonyms:- N-(5-Bromo-3-pyridinyl)cyclopropanesulfonamide
- Cyclopropanesulfonamide, N-(5-bromo-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
