CymitQuimica logo

CAS 1083326-27-5

:

B-[6-Amino-5-(aminosulfonyl)-3-pyridinyl]boronic acid

Description:
B-[6-Amino-5-(aminosulfonyl)-3-pyridinyl]boronic acid is a boronic acid derivative characterized by the presence of a pyridine ring substituted with amino and aminosulfonyl groups. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The amino and aminosulfonyl groups contribute to its potential as a pharmacophore, enhancing its biological activity and solubility in aqueous environments. The presence of the boron atom allows for unique reactivity patterns, particularly in the context of drug design, where it can interact with biological targets. Additionally, this compound may exhibit moderate to high polarity due to its functional groups, influencing its solubility and interaction with other molecules. Overall, B-[6-Amino-5-(aminosulfonyl)-3-pyridinyl]boronic acid is a versatile compound with potential applications in drug development and biochemical research.
Formula:C5H8BN3O4S
InChI:InChI=1S/C5H8BN3O4S/c7-5-4(14(8,12)13)1-3(2-9-5)6(10)11/h1-2,10-11H,(H2,7,9)(H2,8,12,13)
InChI key:InChIKey=ZXJBVDPCLAKYOO-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1C=C(B(O)O)C=NC1N
Synonyms:
  • Boronic acid, B-[6-amino-5-(aminosulfonyl)-3-pyridinyl]-
  • B-[6-Amino-5-(aminosulfonyl)-3-pyridinyl]boronic acid
  • (6-Amino-5-sulfamoylpyridin-3-yl)boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.