CymitQuimica logo

CAS 108333-82-0

:

β-Alanylhistidine

Description:
β-Alanylhistidine, with the CAS number 108333-82-0, is a dipeptide composed of the amino acids β-alanine and histidine. This compound is characterized by its role in biological systems, particularly in the context of peptide synthesis and metabolism. β-Alanylhistidine is known for its potential involvement in various physiological processes, including acting as a precursor for other bioactive molecules. The structure of this dipeptide features a β-alanine moiety linked to a histidine residue, which contributes to its unique properties, such as solubility in water and potential buffering capacity due to the imidazole side chain of histidine. Additionally, β-alanylhistidine may exhibit antioxidant properties and could play a role in cellular signaling pathways. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it of interest in both biochemical research and potential therapeutic applications. Overall, β-alanylhistidine represents a significant compound in the study of peptides and their functions in biological systems.
Formula:C9H14N4O3
InChI:InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)
InChI key:InChIKey=CQOVPNPJLQNMDC-UHFFFAOYSA-N
SMILES:C(CC1=CN=CN1)(NC(CCN)=O)C(O)=O
Synonyms:
  • β-Alanylhistidine
  • 2-(3-Aminopropanamido)-3-(1H-imidazol-5-yl)propanoic acid
  • Histidine, β-alanyl-
  • DL-Carnosine
  • DL-Histidine, N-β-alanyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.