
CAS 1083337-94-3
:1,2,3,4-Tetrahydro-1-(1-methylethyl)-2,4-dioxo-5-pyrimidinesulfonyl chloride
Description:
1,2,3,4-Tetrahydro-1-(1-methylethyl)-2,4-dioxo-5-pyrimidinesulfonyl chloride is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a sulfonyl chloride functional group. This compound typically exhibits properties associated with both heterocyclic compounds and sulfonyl chlorides, such as reactivity towards nucleophiles due to the presence of the sulfonyl chloride group. It may be used in various synthetic applications, particularly in the development of pharmaceuticals or agrochemicals, owing to its potential as an intermediate in organic synthesis. The presence of the dioxo and tetrahydro groups suggests that it may have specific steric and electronic properties that could influence its reactivity and interactions with biological targets. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. Safety precautions are essential when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture.
Formula:C7H9ClN2O4S
InChI:InChI=1S/C7H9ClN2O4S/c1-4(2)10-3-5(15(8,13)14)6(11)9-7(10)12/h3-4H,1-2H3,(H,9,11,12)
InChI key:InChIKey=WWAZDRAWBJBSPN-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CN(C(C)C)C(=O)NC1=O
Synonyms:- 5-Pyrimidinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(1-methylethyl)-2,4-dioxo-
- 1,2,3,4-Tetrahydro-1-(1-methylethyl)-2,4-dioxo-5-pyrimidinesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.