CAS 1083368-79-9: 4-Methoxy-3-(1H-tetrazol-1-yl)benzoic acid

Description:4-Methoxy-3-(1H-tetrazol-1-yl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a methoxy group and a tetrazole moiety. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its reactivity and biological activity. The tetrazole ring, a five-membered heterocyclic structure containing four nitrogen atoms, is known for its stability and is often involved in various pharmacological applications. This compound typically exhibits acidic properties due to the carboxylic acid functional group (-COOH) attached to the benzene ring, allowing it to participate in acid-base reactions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 4-Methoxy-3-(1H-tetrazol-1-yl)benzoic acid is a versatile compound with potential applications in pharmaceuticals and materials science.

Formula:C₉H₈N₄O₃

InChI:InChI=1S/C9H8N4O3/c1-16-8-3-2-6(9(14)15)4-7(8)13-5-10-11-12-13/h2-5H,1H3,(H,14,15)

InChI key:InChIKey=TWBZAJKBINVVPC-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC=C(OC)C(=C1)N2N=NN=C2

Synonyms:
Benzoic acid, 4-methoxy-3-(1H-tetrazol-1-yl)-
4-Methoxy-3-(1H-tetrazol-1-yl)benzoic acid

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	4-Methoxy-3-(1H-1,2,3,4-tetrazol-1-yl)benzoic acid REF: 3D-ITB36879CAS: 1083368-79-9	Min. 95%	To inquire	Tue 15 Apr 25
	4-Methoxy-3-(1h-1,2,3,4-tetrazol-1-yl)benzoic acid REF: 10-F651399CAS: 1083368-79-9	95%	- - -	Discontinued product