CymitQuimica logo

CAS 1083369-09-8

:

4-Amino-1-cyclohexyl-2-pyrrolidinone

Description:
4-Amino-1-cyclohexyl-2-pyrrolidinone, identified by its CAS number 1083369-09-8, is a chemical compound characterized by its unique molecular structure, which includes a pyrrolidinone ring and an amino group. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for amine-containing compounds. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. The cyclohexyl group may contribute to its hydrophobic characteristics, influencing its interaction with biological membranes. Additionally, the amino group can engage in hydrogen bonding, enhancing its reactivity and potential biological activity. Safety and handling considerations are essential, as with many organic compounds, and appropriate precautions should be taken to mitigate any risks associated with exposure. Overall, 4-Amino-1-cyclohexyl-2-pyrrolidinone represents a compound of interest in both research and industrial applications, particularly in the fields of organic synthesis and drug development.
Formula:C10H18N2O
InChI:InChI=1S/C10H18N2O/c11-8-6-10(13)12(7-8)9-4-2-1-3-5-9/h8-9H,1-7,11H2
InChI key:InChIKey=KBEMXFCEFKMIBX-UHFFFAOYSA-N
SMILES:O=C1N(CC(N)C1)C2CCCCC2
Synonyms:
  • 4-Amino-1-cyclohexyl-2-pyrrolidinone
  • 2-Pyrrolidinone, 4-amino-1-cyclohexyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.