CAS 1083401-51-7

5-(5-Methyl-2-thienyl)-4-oxazolecarboxylic acid

Description:

5-(5-Methyl-2-thienyl)-4-oxazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thienyl group and an oxazole ring. The presence of the thienyl moiety contributes to its aromatic properties, while the oxazole ring introduces heteroatoms that can influence its reactivity and solubility. This compound typically exhibits moderate polarity due to the carboxylic acid functional group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The methyl group on the thienyl ring can affect the compound's electronic properties and steric hindrance, potentially influencing its biological activity. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in pharmaceuticals and organic synthesis. Additionally, the presence of both the thienyl and oxazole functionalities may impart unique optical or electronic properties, making them suitable for various applications in organic electronics or as intermediates in chemical synthesis.

Formula: C₉H₇NO₃S

InChI: InChI=1S/C9H7NO3S/c1-5-2-3-6(14-5)8-7(9(11)12)10-4-13-8/h2-4H,1H3,(H,11,12)

InChI key: InChIKey=DNSWZMIXQAYCRZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OC=N1)C=2SC(C)=CC2

Synonyms:

• 5-(5-Methyl-2-thienyl)-4-oxazolecarboxylic acid
• 4-Oxazolecarboxylic acid, 5-(5-methyl-2-thienyl)-