CAS 1083402-26-9

6-Fluoro-1,2-benzisoxazole-3-methanamine

Description:

6-Fluoro-1,2-benzisoxazole-3-methanamine is a chemical compound characterized by its unique structure, which includes a benzisoxazole ring system substituted with a fluorine atom and a methanamine group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the amine functional group. The fluorine substitution can influence its reactivity and lipophilicity, potentially enhancing its pharmacological properties. It may be soluble in polar solvents, depending on the specific functional groups and their interactions. The compound's molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, its CAS number, 1083402-26-9, allows for precise identification in chemical databases, facilitating research and application in various fields, including drug discovery and materials science. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₈H₇FN₂O

InChI: InChI=1S/C8H7FN2O/c9-5-1-2-6-7(4-10)11-12-8(6)3-5/h1-3H,4,10H2

InChI key: InChIKey=VLOWYMFNFSVUDD-UHFFFAOYSA-N

SMILES: C(N)C=1C=2C(ON1)=CC(F)=CC2

Synonyms:

• 6-Fluoro-1,2-benzisoxazole-3-methanamine
• 1,2-Benzisoxazole-3-methanamine, 6-fluoro-
• (6-Fluorobenzo[d]isoxazol-3-yl)methanamine
• (6-Fluoro-1,2-benzoxazol-3-yl)methanamine

(6-Fluorobenzo[d]isoxazol-3-yl)methanamine

CAS: 1083402-26-9

(6-Fluorobenzo[d]isoxazol-3-yl)methanamine

Purity: 95%

Molecular weight: 166.15g/mol

Ref: 54-PC102969

(6-Fluorobenzo[d]isoxazol-3-yl)methanamine

CAS: 1083402-26-9

Purity: 95%

Molecular weight: 166.1549988

Ref: 10-F699956