CAS 108347-81-5
:6-phosphogluconic acid tris(cyclohexyl-amine) salt
Description:
6-Phosphogluconic acid tris(cyclohexyl-amine) salt is a chemical compound that serves as a salt formed from the reaction of 6-phosphogluconic acid and cyclohexylamine. This compound typically exhibits characteristics associated with both its acidic and amine components. It is likely to be a white to off-white solid, soluble in polar solvents due to the presence of the phosphonic acid group, which can engage in hydrogen bonding. The cyclohexylamine moieties contribute to its hydrophobic properties, potentially affecting its solubility and stability in various environments. The compound may be used in biochemical applications, particularly in studies involving metabolic pathways, as 6-phosphogluconic acid is an intermediate in the pentose phosphate pathway. Additionally, the presence of cyclohexylamine can influence the compound's pH and buffering capacity. As with many salts, the stability and reactivity of this compound can be influenced by environmental factors such as temperature and pH. Proper handling and storage conditions are essential to maintain its integrity and functionality in laboratory settings.
Formula:C15H26N2
InChI:InChI=1/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12?,13?,14-,15+
Synonyms:- 6-Phosphogluconic acid tri(cyclohexylammonium) salt
- 6-phosphogluconic acid*cyclohexylammonium grade V
- 6-Phosphogluconic acid, cyclohexylammonium salt
- Sparteine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Phosphogluconic acid tri(cyclohexylammonium) salt
CAS:Formula:C6H13O10P·3C6H13NMolecular weight:573.66
