CAS 108347-96-2

N6-monobutyryl-2'-deoxyadenosine*3':5'-cyclic mon

Description:

N6-monobutyryl-2'-deoxyadenosine 3':5'-cyclic monophosphate, commonly referred to as N6-monobutyryl-2'-deoxyadenosine, is a nucleotide analog characterized by the presence of a butyryl group at the N6 position of the adenine base and a cyclic phosphate group. This compound is a derivative of 2'-deoxyadenosine, which is a nucleoside that forms part of DNA. The cyclic monophosphate structure indicates that it has a phosphate group that is part of a cyclic arrangement, which can influence its biochemical properties and interactions. This compound is often studied for its potential roles in cellular signaling and as a tool in biochemical research, particularly in the context of nucleotide metabolism and enzyme interactions. Its unique structural features may also affect its stability, solubility, and ability to participate in biochemical reactions, making it a subject of interest in medicinal chemistry and pharmacology.

Formula: C₁₄H₁₈N₅NaO₆P

InChI: InChI=1/C14H18N5O6P.Na/c1-2-3-10(20)18-13-12-14(16-6-15-13)19(7-17-12)11-4-8-9(24-11)5-23-26(21,22)25-8;/h6-9,11H,2-5H2,1H3,(H,21,22)(H,15,16,18,20);

SMILES: CCCC(=Nc1c2c(ncn1)n(cn2)C1CC2C(COP(=O)(O)O2)O1)O.[Na]

Synonyms:

• butanamide, N-[9-(tetrahydro-2-hydroxy-2-oxido-4H-furo[3,2-d]-1,3,2-dioxaphosphorin-6-yl)-9H-purin-6-yl]-, monosodium salt

N6-Monobutyryl-2'-deoxyadenosine 3',5'-cyclic monophosphate sodium salt

CAS: 108347-96-2

N6-Monobutyryl-2'-deoxyadenosine 3',5'-cyclic monophosphate sodium salt is a novel antiviral and anticancer agent that is a synthetic nucleoside analogue. It has been shown to be effective at inhibiting the growth of human cancer cells in vitro and in vivo. N6-Monobutyryl-2'-deoxyadenosine 3',5'-cyclic monophosphate sodium salt binds to viral RNA, resulting in inhibition of protein synthesis and cell death.

Formula: C₁₄H₁₈N₅O₆P·Na

Purity: Min. 95%

Molecular weight: 406.29 g/mol

Ref: 3D-NM158717