CAS 108351-50-4
:Glidobactin A
Description:
Glidobactin A is a natural product classified as a polyketide, originally isolated from the bacterium *Glidobacte* species. It exhibits a complex molecular structure characterized by multiple rings and functional groups, contributing to its biological activity. This compound has garnered attention for its potential antimicrobial properties, particularly against various strains of bacteria. Glidobactin A operates through mechanisms that may involve interference with bacterial cell wall synthesis or other vital cellular processes. Its unique structure and biological activity make it a subject of interest in medicinal chemistry and drug development. Additionally, research into Glidobactin A may provide insights into the development of novel antibiotics, especially in the context of rising antibiotic resistance. As with many natural products, the extraction and synthesis of Glidobactin A can be challenging, necessitating advanced techniques in organic chemistry for its study and potential application. Overall, Glidobactin A represents a promising avenue for further exploration in the field of pharmacology and microbiology.
Formula:C27H44N4O6·H2O
InChI:InChI=1/C27H44N4O6/c1-4-5-6-7-8-9-10-11-12-13-24(35)31-25(20(3)32)27(37)30-22-18-21(33)16-17-28-23(34)15-14-19(2)29-26(22)36/h10-15,19-22,25,32-33H,4-9,16-18H2,1-3H3,(H,28,34)(H,29,36)(H,30,37)(H,31,35)/b11-10+,13-12+,15-14-/t19-,20+,21-,22-,25-/m0/s1
Synonyms:- (2E,4E)-N-[(1S,2R)-2-Hydroxy-1-[[[[(3E,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3-en]-8-yl]amino]carbonyl]propyl]-2,4-dodecadienamide
- Cepafungin II
- BU-2867TA
- Glidobactin A
- Glidbactin A
- Antibiotic BU-2867TA
- (2E,4E)-N-[(1S,2R)-2-hydroxy-1-{[(3Z,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]carbamoyl}propyl]dodeca-2,4-dienamide
- 2,4-Dodecadienamide, N-(2-hydroxy-1-(((10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl)amino)carbonyl)propyl)-, hemihydrate (5S-(3E,5R*,8R*(1R*(2E,4E),2S*),10R*))-
- 2,4-Dodecadienamide, N-(2-hydroxy-1-(((10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl)amino)carbonyl)propyl)-, (5S-(3E,5R*,8R*(1R*(2E,4E),2S*),10R*))-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glidobactin A
CAS:Glidobactin A is an acyl-peptide antibiotic. It exhibits activity against Candida, Aspergillus fumigatus, and Trichophyton, but it is ineffective against Candida albicans M-9 infection in mice.Color and Shape:Solid

