CAS 108351-52-6
:glidobactin C
Description:
Glidobactin C is a natural product classified as a secondary metabolite, specifically belonging to the class of polyketides. It is produced by certain strains of bacteria, notably those in the genus *Streptomyces*. This compound exhibits a complex molecular structure characterized by multiple functional groups, which contribute to its biological activity. Glidobactin C has garnered interest due to its potential antimicrobial properties, making it a subject of research in the field of medicinal chemistry. Its mechanism of action may involve interference with bacterial cell wall synthesis or other vital cellular processes. Additionally, glidobactin C may exhibit cytotoxic effects against various cancer cell lines, highlighting its potential as a lead compound in drug development. The compound's stability, solubility, and reactivity can vary based on environmental conditions, which are important factors to consider in both laboratory and therapeutic applications. Overall, glidobactin C represents a promising area of study for its potential applications in pharmaceuticals and biotechnology.
Formula:C29H48N4O6
InChI:InChI=1/C29H48N4O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-26(37)33-27(22(3)34)29(39)32-24-20-23(35)18-19-30-25(36)17-16-21(2)31-28(24)38/h12-17,21-24,27,34-35H,4-11,18-20H2,1-3H3,(H,30,36)(H,31,38)(H,32,39)(H,33,37)/b13-12+,15-14+,17-16-/t21-,22+,23-,24-,27-/m0/s1
Synonyms:- Antibiotic BU-2867TC
- BU-2867TC
- Antibioti BU-2867TC
- (2E,4E)-N-[(1S,2R)-2-Hydroxy-1-[[[[(3E,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3-en]-8-yl]amino]carbonyl]propyl]-2,4-tetradecadienamide
- glidobactin C
- 2,4-Tetradecadienamide, N-(2-hydroxy-1-(((10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl)amino)carbonyl)propyl)-, (5S-(3E,5R*,8R*(1R*(2E,4E),2S*),10R*))-
- (2E,4E)-N-[(1S,2R)-2-hydroxy-1-{[(3Z,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]carbamoyl}propyl]tetradeca-2,4-dienamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glidobactin C
CAS:Glidobactin C (GlbC) is an antitumor antibiotic with activity against pathogenic fungi and yeasts. It exhibits antifungal properties against Candida albicans and Aspergillus fumigatus, with a minimum inhibitory concentration (MIC) of 0.8 μg/mL. Additionally, Glidobactin C prolongs the survival time of mice inoculated with leukemia P388 cells.Formula:C29H48N4O6Color and Shape:SolidMolecular weight:548.715
