CymitQuimica logo

CAS 108353-14-6

:

(6S,7S)-7-{[(2-amino-1,3-thiazol-4-yl){[(1,5-dihydroxy-4-oxo-1,4-dihydropyridin-2-yl)carbonyl]amino}acetyl]amino}-3-({[1-(2-hydroxyethyl)pyridinium-4-yl]sulfanyl}methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate

Description:
The chemical substance with the name "(6S,7S)-7-{[(2-amino-1,3-thiazol-4-yl){[(1,5-dihydroxy-4-oxo-1,4-dihydropyridin-2-yl)carbonyl]amino}acetyl]amino}-3-({[1-(2-hydroxyethyl)pyridinium-4-yl]sulfanyl}methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate" and CAS number "108353-14-6" is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as thiazole, pyridine, and a bicyclic system. This compound exhibits properties typical of antibiotics, particularly those that target bacterial ribosomes, due to its thiazole and bicyclic moieties. Its solubility profile may vary depending on the pH and the presence of other ions, which can influence its bioavailability and pharmacokinetics. The presence of hydroxyl and amino groups suggests potential for hydrogen bonding, impacting its interaction with biological targets. Additionally, the compound's stereochemistry, indicated by the (6S,7S) configuration, is crucial for its biological activity, as stereoisomers can exhibit significantly different pharmacological effects. Overall, this substance represents a class of compounds with potential therapeutic applications, particularly in antimicrobial treatments.
Formula:C26H25N7O9S3
InChI:InChI=1/C26H25N7O9S3/c27-26-28-14(11-45-26)18(29-21(37)15-7-16(35)17(36)8-32(15)42)22(38)30-19-23(39)33-20(25(40)41)12(10-44-24(19)33)9-43-13-1-3-31(4-2-13)5-6-34/h1-4,7-8,11,18-19,24,34,42H,5-6,9-10H2,(H5-,27,28,29,30,36,37,38,40,41)/t18?,19-,24-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • MT0703

    CAS:
    MT0703 is a cephalosporin antibiotic featuring an aminothiazolylglycyl moiety with a 1,5-dihydroxy-4-pyridinone-2-carbonyl group, displaying potent activity against Pseudomonas species.
    Formula:C26H25N7O9S3
    Color and Shape:Solid
    Molecular weight:675.71