
CAS 108354-13-8
:Aurachin D
Description:
Aurachin D is a chemical compound classified as a quinone derivative, specifically known for its role as a natural product with potential biological activity. It is characterized by its unique structure, which includes a bicyclic system that contributes to its reactivity and interaction with biological targets. Aurachin D has garnered interest in the field of medicinal chemistry due to its antimicrobial properties, particularly against certain bacterial strains. The compound is often studied for its potential applications in drug development, especially in the context of combating antibiotic resistance. Additionally, Aurachin D may exhibit other pharmacological effects, making it a subject of research in various biochemical studies. Its synthesis and characterization involve advanced organic chemistry techniques, and ongoing research aims to elucidate its mechanisms of action and optimize its efficacy for therapeutic use. Overall, Aurachin D represents a significant compound in the exploration of natural products for medicinal applications.
Formula:C25H33NO
InChI:InChI=1S/C25H33NO/c1-18(2)10-8-11-19(3)12-9-13-20(4)16-17-22-21(5)26-24-15-7-6-14-23(24)25(22)27/h6-7,10,12,14-16H,8-9,11,13,17H2,1-5H3,(H,26,27)/b19-12+,20-16+
InChI key:InChIKey=JHMLNOXMSHURLQ-YEFHWUCQSA-N
SMILES:O=C1C=2C(NC(C)=C1C/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)=CC=CC2
Synonyms:- 2-Methyl-3-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-4(1H)-quinolinone
- Aurachin D
- 4(1H)-Quinolinone, 2-methyl-3-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Aurachin D
CAS:Aurachin D, a cytotoxic quinolone targeting Mycobacterium tuberculosis (Mtb) cytochrome bd oxidase, acts as an antibiotic against malaria, Plasmodium spp.Formula:C25H33NOPurity:98%Color and Shape:SolidMolecular weight:363.542-Methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-quinolin-4-one
CAS:<p>2-Methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-quinolin-4-one is a ligand that binds to the receptor and activates it. It is also an agonist of the ion channel. The 2-methyl group in this compound is responsible for binding to the receptor and activating it. The 1H quinolin-4one moiety is responsible for binding to the ion channel. This compound has been shown to be a potent inhibitor of protein interactions. The high purity of this compound makes it suitable for use in research tools such as antibody production and recombinant protein production.</p>Formula:C25H33NOPurity:Min. 95%Molecular weight:363.5 g/mol

