CAS 108354-14-9

Aurachin C

Description:

Aurachin C is a chemical compound classified as a quinone derivative, specifically known for its role as a natural product with potential biological activity. It is characterized by its distinctive aromatic structure, which contributes to its reactivity and interaction with biological systems. Aurachin C exhibits antimicrobial properties, making it of interest in pharmaceutical research, particularly in the development of new antibiotics. The compound is typically derived from certain bacterial species, particularly those within the genus *Burkholderia*. Its molecular structure includes multiple functional groups that enhance its solubility and reactivity. Additionally, Aurachin C has been studied for its potential applications in cancer therapy due to its ability to induce apoptosis in certain cancer cell lines. As with many natural products, the synthesis and extraction of Aurachin C can be complex, often requiring specific conditions to maintain its stability and efficacy. Overall, Aurachin C represents a significant area of interest in medicinal chemistry and natural product research.

Formula: C₂₅H₃₃NO₂

InChI: InChI=1/C25H33NO2/c1-18(2)10-8-11-19(3)12-9-13-20(4)16-17-22-21(5)26(28)24-15-7-6-14-23(24)25(22)27/h6-7,10,12,14-16,28H,8-9,11,13,17H2,1-5H3/b19-12+,20-16+

InChI key: InChIKey=FIHXCHBEHLCXEG-YEFHWUCQSA-N

SMILES: O=C1C=2C(N(O)C(C)=C1C/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)=CC=CC2

Synonyms:

• 4(1H)-Quinolinone, 1-hydroxy-2-methyl-3-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-
• Aurachin-C
• Aurachin C
• 1-hydroxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-4(1H)-one
• 4(1H)-Quinolinone, 1-hydroxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-
• 1-Hydroxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-4(1H)-quinolinone
• 1-Hydroxy-2-methyl-3-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-4(1H)-quinolinone

Aurachin C

CAS: 108354-14-9

Aurachin C is a quinoline alkaloid belonging to the isoprenoid class, known for its antimalarial, antifungal, and antibacterial properties. It acts as a selective terminal oxidase inhibitor.

Formula: C₂₅H₃₃NO₂

Color and Shape: Solid

Molecular weight: 379.535

Ref: TM-T205174