CAS 108354-47-8
:2-AMINO-3-METHYL-3H-IMIDAZO[4,5-F]QUINOXALINE
Description:
2-Amino-3-methyl-3H-imidazo[4,5-f]quinoxaline is a heterocyclic compound characterized by its fused imidazole and quinoxaline rings, which contribute to its unique chemical properties. This compound typically exhibits a molecular formula that reflects its complex structure, featuring nitrogen and carbon atoms that are integral to its aromatic character. It is known for its potential biological activity, particularly in the context of pharmacology, where it may act as a scaffold for developing therapeutic agents. The presence of amino and methyl groups enhances its reactivity and solubility in various solvents. Additionally, this compound may exhibit fluorescence, making it useful in certain analytical applications. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-amino-3-methyl-3H-imidazo[4,5-f]quinoxaline represents a significant class of compounds in medicinal chemistry, with ongoing research exploring its potential applications in drug development and other fields.
Formula:C10H9N5
InChI:InChI=1/C10H9N5/c1-15-7-3-2-6-8(13-5-4-12-6)9(7)14-10(15)11/h2-5H,1H3,(H2,11,14)
InChI key:InChIKey=HKZZYGFWIFKKIR-UHFFFAOYSA-N
SMILES:Cn1c2ccc3c(c2[nH]c1=N)nccn3
Synonyms:- 2-Amino-3-Methylimidazo[4,5-f]quinoxaline
- 3-Methylimidazo[4,5-f]quinoxalin-2-amine
- 3-methyl-3H-imidazo[4,5-f]quinoxalin-2-amine
- 3H-Imidazo[4,5-f]quinoxalin-2-amine, 3-methyl-
- 3H-Imidazo[4,5-f]quinoxalin-2-amine,3-methyl-(9CI)
- IQX
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-3-methyl-3H-imidazo[4,5-F]quinoxaline
CAS:Controlled ProductApplications Exhibits an extraordinarily high mutagenic potency in the Ames test.
References Becher, et al.: Carcinogenesis, 9, 247 (1988), Sugimura, T., et al.: Mutation Research, 290, 43 (1993), Eisenbrand & Tang: Toxicology, 84, 1 (1993), Vikse, R., et al.: Mutation Research, 298, 207 (1993)Formula:C10H9N5Color and Shape:NeatMolecular weight:199.21
