CAS 108354-48-9
:2-Amino-3,4-dimethylimidazo[4,5-f]quinoxaline
Description:
2-Amino-3,4-dimethylimidazo[4,5-f]quinoxaline, commonly referred to as MeIQx, is a heterocyclic aromatic amine that is primarily formed during the cooking of meat at high temperatures, such as grilling or frying. This compound is characterized by its fused imidazole and quinoxaline rings, which contribute to its chemical stability and potential mutagenic properties. MeIQx is known for its ability to form DNA adducts, which can lead to mutations and have been implicated in carcinogenic processes. It is soluble in organic solvents but has limited solubility in water. The compound is of significant interest in food safety and toxicology due to its presence in cooked foods and its potential health risks. Regulatory agencies monitor its levels in food products, and ongoing research aims to better understand its mechanisms of action and the implications for human health. Overall, MeIQx serves as a critical example of how cooking methods can influence the formation of potentially harmful substances in food.
Formula:C11H11N5
InChI:InChI=1S/C11H11N5/c1-6-5-7-8(14-4-3-13-7)9-10(6)16(2)11(12)15-9/h3-5H,1-2H3,(H2,12,15)
InChI key:InChIKey=NCJALZQHQFQOPX-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=3C(C1)=NC=CN3)N=C(N)N2C
Synonyms:- 2-Amino-3,4-Dimethylimidazo(4,5-F)Quinoxaline
- 3,4-Dimethylimidazo[4,5-f]quinoxalin-2-amine
- 3,4-dimethyl-3H-imidazo[4,5-f]quinoxalin-2-amine
- 3H-Imidazo[4,5-f]quinoxalin-2-amine, 3,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-3,4-dimethylimidazo[4,5-f]quinoxaline
CAS:Controlled ProductFormula:C11H11N5Color and Shape:NeatMolecular weight:213.24
