CAS 108368-14-5
:2-[5-(4-aminophenoxy)pentyl]-4-nitro-1H-isoindole-1,3(2H)-dione
Description:
2-[5-(4-aminophenoxy)pentyl]-4-nitro-1H-isoindole-1,3(2H)-dione, with the CAS number 108368-14-5, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoindole core substituted with a nitro group and a long alkyl chain featuring an aminophenoxy moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of the amino and nitro functional groups, which can influence its reactivity and interactions with biological systems. The isoindole structure is known for its role in various pharmacological applications, and the specific substitutions on this compound may impart unique characteristics, such as enhanced binding affinity to certain biological targets or altered pharmacokinetic properties. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry research for its potential therapeutic applications. Safety and handling precautions should be observed due to the presence of the nitro group, which can be sensitive to reduction reactions.
Formula:C19H19N3O5
InChI:InChI=1/C19H19N3O5/c20-13-7-9-14(10-8-13)27-12-3-1-2-11-21-18(23)15-5-4-6-16(22(25)26)17(15)19(21)24/h4-10H,1-3,11-12,20H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phthalimide, N-(5-(p-aminophenoxy)pentyl)-3-nitro-
CAS:<p>Phthalimide, N-(5-(p-aminophenoxy)pentyl)-3-nitro- is a bioactive chemical.</p>Formula:C19H19N3O5Color and Shape:SolidMolecular weight:369.37
