CAS 1084-76-0: N-(2,4-Dinitrophenyl)glycine
Description:N-(2,4-Dinitrophenyl)glycine, with the CAS number 1084-76-0, is an organic compound characterized by its structure, which includes a glycine moiety linked to a 2,4-dinitrophenyl group. This compound is typically a yellow crystalline solid due to the presence of the dinitrophenyl group, which is known for its strong electron-withdrawing properties. It is soluble in polar solvents like water and alcohols, but less soluble in non-polar solvents. The presence of the dinitro substituents imparts significant reactivity, making it useful in various chemical reactions, particularly in the synthesis of other organic compounds. N-(2,4-Dinitrophenyl)glycine is often employed in biochemical applications, including as a reagent in the study of amino acids and proteins. Additionally, it can serve as a potential indicator in titrations due to its color change properties. However, due to the toxicity associated with dinitrophenyl compounds, appropriate safety measures should be taken when handling this substance.
Formula:C8H7N3O6
InChI:InChI=1S/C8H7N3O6/c12-8(13)4-9-6-2-1-5(10(14)15)3-7(6)11(16)17/h1-3,9H,4H2,(H,12,13)
InChI key:InChIKey=RQPREKYEHBAOAR-UHFFFAOYSA-N
SMILES:O=C(O)CNC1=CC=C(C=C1N(=O)=O)N(=O)=O
- Synonyms:
- 2,4-Dinitrophenylglycine
- 2-(2,4-Dinitroanilino)acetic acid
- 2-[(2,4-Dinitrophenyl)amino]acetic acid
- DNP-Glycine 2,4-Dinitrophenyl-glycine
- DNP-glycine
- Glycine, N-(2,4-dinitrophenyl)-
- N-(2,4-Dinitrophenyl glycine
- N<sup>α</sup>-2,4-Dinitrophenylglycine
- NSC 37410
- Nα-2,4-Dinitrophenylglycine
- See more synonyms
- N-2,4-DNP-glycine
