CAS 108405-58-9
:QA 241
Description:
QA 241, with the CAS number 108405-58-9, is a chemical compound that has garnered attention in various fields, particularly in research and development. It is characterized by its specific molecular structure, which contributes to its unique properties and potential applications. Typically, compounds like QA 241 may exhibit characteristics such as solubility in certain solvents, stability under various conditions, and reactivity with other chemical species. The compound may also possess biological activity, making it relevant in pharmacological studies or as a potential therapeutic agent. Its safety profile, including toxicity and environmental impact, is crucial for its handling and application. As with any chemical substance, understanding its characteristics requires comprehensive analysis, including spectroscopic methods and empirical studies to elucidate its behavior in different environments. Researchers often explore its interactions, efficacy, and mechanisms of action to fully harness its potential in scientific and industrial applications.
Formula:C19H21ClFN3O4
InChI:InChI=1/C19H20FN3O4.ClH/c1-10-7-14(24)15-16-11(18(25)12(19(26)27)9-23(10)16)8-13(20)17(15)22-5-3-21(2)4-6-22;/h8-10H,3-7H2,1-2H3,(H,26,27);1H
SMILES:CC1CC(=O)c2c3c(cc(c2N2CCN(C)CC2)F)c(=O)c(cn13)C(=O)O.Cl
Synonyms:- 9-Fluoro-6,7-dihydro-5-methyl-8-(4-methyl-1-piperazinyl)-1,7-dioxo-1H,5H-benzo(ij)quinolizine-2-carboxylic acid
- 1H,5H-Benzo(ij)quinolizine-2-carboxylic acid, 9-fluoro-6,7-dihydro-5-methyl-8-(4-methyl-1-piperazinyl)-1,7-dioxo-, monohydrochloride
- 9-fluoro-5-methyl-8-(4-methylpiperazin-1-yl)-1,7-dioxo-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-2-carboxylic acid hydrochloride (1:1)
- QA-241
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
QA 241
CAS:QA 241 is a tricyclic quinolone.Formula:C19H21ClFN3O4Color and Shape:SolidMolecular weight:409.84
