
CAS 108413-26-9
:1-(3-Buten-1-yl)-1H-benzimidazole
Description:
1-(3-Buten-1-yl)-1H-benzimidazole is an organic compound characterized by its unique structure, which combines a benzimidazole moiety with a butenyl side chain. The benzimidazole ring system is known for its aromatic properties and ability to participate in various chemical reactions, making it a versatile scaffold in medicinal chemistry. The presence of the butenyl group introduces unsaturation, which can enhance reactivity and influence the compound's physical properties, such as boiling and melting points. This compound may exhibit biological activity, potentially serving as a lead compound in drug development, particularly in areas like cancer research or antimicrobial studies. Its solubility and stability in different solvents can vary, impacting its application in various chemical processes. Additionally, the compound's molecular interactions, such as hydrogen bonding and π-π stacking, can play a significant role in its behavior in biological systems. Overall, 1-(3-Buten-1-yl)-1H-benzimidazole represents a class of compounds with potential utility in pharmaceuticals and materials science.
Formula:C11H12N2
InChI:InChI=1S/C11H12N2/c1-2-3-8-13-9-12-10-6-4-5-7-11(10)13/h2,4-7,9H,1,3,8H2
InChI key:InChIKey=DIHJKNFBITXNKT-UHFFFAOYSA-N
SMILES:C(CC=C)N1C=2C(N=C1)=CC=CC2
Synonyms:- 1-(3-Buten-1-yl)benzimidazole
- 1-(3-Butenyl)benzimidazole
- 1H-Benzimidazole, 1-(3-buten-1-yl)-
- 1H-Benzimidazole, 1-(3-butenyl)-
- 1-(3-Buten-1-yl)-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.