CAS 108428-39-3
:N-[(1S)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-L-proline 1,1-dimethylethyl ester
Description:
N-[(1S)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-L-proline 1,1-dimethylethyl ester, with the CAS number 108428-39-3, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a complex structure characterized by the presence of an ethoxycarbonyl group, a phenylpropyl moiety, and two amino acid components, L-alanine and L-proline. The presence of the tert-butyl ester group enhances its lipophilicity, which can influence its solubility and bioavailability. The compound may exhibit specific biological activities due to its structural features, making it of interest in medicinal chemistry and pharmaceutical research. Its stereochemistry, particularly the (1S) configuration, is crucial for its potential interactions with biological targets. As with many amino acid derivatives, it may participate in various chemical reactions, including peptide bond formation, and could serve as a building block for more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C24H36N2O5
InChI:InChI=1S/C24H36N2O5/c1-6-30-22(28)19(15-14-18-11-8-7-9-12-18)25-17(2)21(27)26-16-10-13-20(26)23(29)31-24(3,4)5/h7-9,11-12,17,19-20,25H,6,10,13-16H2,1-5H3/t17-,19-,20-/m0/s1
InChI key:InChIKey=COROOYFPXSPNBH-IHPCNDPISA-N
SMILES:C(OC(C)(C)C)(=O)[C@H]1N(C([C@@H](N[C@@H](CCC2=CC=CC=C2)C(OCC)=O)C)=O)CCC1
Synonyms:- L-Proline, 1-[N-[1-(ethoxycarbonyl)-3-phenylpropyl]-L-alanyl]-, 1,1-dimethylethyl ester, (S)-
- N-[(1S)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-L-proline 1,1-dimethylethyl ester
- L-Proline, N-[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-, 1,1-dimethylethyl ester
- Enalapril tert-butyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Enalapril tert-Butyl Ester
CAS:Controlled ProductApplications Protected Enalapril (E555250), an antihypertensive and an angiotensin-converting enzyme (ACE) inhibitor.
References Iwasaki, G. et a.: Chem. Pharm. Bull., 37, 280, 1989; Miyake, A. et al.: Chem. Pharm. Bull., 34, 2852 (1986)Formula:C24H36N2O5Color and Shape:NeatMolecular weight:432.55

