CAS 1084328-82-4
:3-Bromo-1H-indol-7-amine
Description:
3-Bromo-1H-indol-7-amine is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 3-position and an amino group at the 7-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It is often used as an intermediate in the synthesis of various pharmaceuticals and biologically active compounds due to its ability to participate in further chemical reactions, such as nucleophilic substitutions or coupling reactions. The bromine substituent can also serve as a useful handle for further functionalization. Safety data sheets should be consulted for handling and storage guidelines, as compounds containing halogens and amines can pose health risks. Overall, 3-Bromo-1H-indol-7-amine is a valuable compound in organic synthesis and drug development.
Formula:C8H7BrN2
InChI:InChI=1S/C8H7BrN2/c9-6-4-11-8-5(6)2-1-3-7(8)10/h1-4,11H,10H2
InChI key:InChIKey=AOTCBNORDMIMEB-UHFFFAOYSA-N
SMILES:NC1=C2C(C(Br)=CN2)=CC=C1
Synonyms:- 1H-Indol-7-amine, 3-bromo-
- 3-Bromo-1H-indol-7-amine
- 3-Bromo-1H-indol-7-ylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.