CAS 108433-95-0
:magainin ii
Description:
Magainin II is a peptide that is derived from the skin of the African clawed frog, Xenopus laevis. It is known for its antimicrobial properties, particularly against a range of bacteria and fungi. The peptide consists of 23 amino acids and features a cationic nature, which contributes to its ability to disrupt microbial membranes. Magainin II exhibits a helical structure in membrane-mimicking environments, enhancing its interaction with lipid bilayers. Its mechanism of action typically involves the formation of pores in the membranes of target microorganisms, leading to cell lysis. This peptide is of significant interest in biomedical research for its potential applications in developing new antimicrobial agents, especially in the face of rising antibiotic resistance. Additionally, magainin II has been studied for its immunomodulatory effects and potential roles in wound healing. Its stability and efficacy make it a candidate for further exploration in therapeutic applications.
Formula:C114H180N30O29S
InChI:InChI=1/C114H180N30O29S/c1-12-65(7)94(142-88(148)55-119)112(170)124-59-90(150)129-74(38-24-28-45-116)100(158)137-81(51-70-33-19-15-20-34-70)106(164)135-79(49-63(3)4)105(163)138-83(53-72-56-121-62-125-72)107(165)140-85(60-145)110(168)127-67(9)96(154)131-75(39-25-29-46-117)101(159)132-76(40-26-30-47-118)102(160)136-80(50-69-31-17-14-18-32-69)98(156)122-57-89(149)128-73(37-23-27-44-115)99(157)126-68(10)97(155)134-82(52-71-35-21-16-22-36-71)109(167)143-93(64(5)6)111(169)123-58-91(151)130-77(41-42-92(152)153)104(162)144-95(66(8)13-2)113(171)133-78(43-48-174-11)103(161)139-84(54-87(120)147)108(166)141-86(61-146)114(172)173/h14-22,31-36,56,62-68,73-86,93-95,145-146H,12-13,23-30,37-55,57-61,115-119H2,1-11H3,(H2,120,147)(H,121,125)(H,122,156)(H,123,169)(H,124,170)(H,126,157)(H,127,168)(H,128,149)(H,129,150)(H,130,151)(H,131,154)(H,132,159)(H,133,171)(H,134,155)(H,135,164)(H,136,160)(H,137,158)(H,138,163)(H,139,161)(H,140,165)(H,141,166)(H,142,148)(H,143,167)(H,144,162)(H,152,153)(H,172,173)/t65-,66-,67-,68-,73-,74-,75-,76-,77-,78-,79-,80-,81-,82-,83-,84-,85-,86-,93-,94-,95-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NCC(=N[C@@H](CCCCN)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CC(C)C)C(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H](CO)C(=N[C@@H](C)C(=N[C@@H](CCCCN)C(=N[C@@H](CCCCN)C(=N[C@@H](Cc1ccccc1)C(=NCC(=N[C@@H](CCCCN)C(=N[C@@H](C)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](C(C)C)C(=NCC(=N[C@@H](CCC(=O)O)C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](CCSC)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CO)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(CN)O
Synonyms:- H-Gly-Ile-Gly-Lys-Phe-Leu-His-Ser-Ala-Lys-Lys-Phe-Gly-Lys-Ala-Phe-Val-Gly-Glu-Ile-Met-Asn-Ser-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Magainin II
CAS:Magainin II belongs to a naturally occurring class of non-hemolytic vertebrate peptides with potent antibiotic properties, originally isolated from frog skin. At concentrations over 2 µM, it causes a change in membrane permeability and forms cation-selective channels.Formula:C114H180N30O29SPurity:96.1%Color and Shape:White LyophilisateMolecular weight:2466.93Magainin 2
CAS:Magainin II is a member of the antimicrobial peptides familyFormula:C114H180N30O29SPurity:>99.99%Color and Shape:SolidMolecular weight:2466.9Ref: TM-TP1444
1mg155.00€5mg369.00€10mg550.00€25mg882.00€50mg1,198.00€100mg1,605.00€200mg2,157.00€500µg96.00€Magainin 2
CAS:Magainin 2 is an antimicrobial peptide, which is derived from the skin of the African clawed frog, *Xenopus laevis*. This peptide is renowned for its membrane-disrupting mode of action, where it integrates into lipid bilayers of microbial cell membranes, ultimately leading to disruption and cell lysis. The mode of action is primarily through the formation of pores in the membrane, causing a loss of cellular contents and death of the microbial cell.Formula:C114H180N30O29SPurity:Min. 95%Molecular weight:2,466.9 g/mol





