
CAS 108437-47-4
:3-Methyl-3,9-diazabicyclo[4.2.1]nonane
Description:
3-Methyl-3,9-diazabicyclo[4.2.1]nonane, with the CAS number 108437-47-4, is a bicyclic organic compound characterized by its unique structure, which includes a bicyclic framework and two nitrogen atoms incorporated into the ring system. This compound features a methyl group at the 3-position, contributing to its overall stability and reactivity. It is classified as a diazabicyclic amine, which often exhibits basic properties due to the presence of nitrogen atoms. The compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications as a ligand or catalyst. Its structural features may influence its solubility, boiling point, and reactivity with other chemical species. Additionally, the presence of nitrogen atoms can enhance its ability to participate in hydrogen bonding and coordination with metal ions. Overall, 3-Methyl-3,9-diazabicyclo[4.2.1]nonane represents a fascinating subject for further research in chemical reactivity and applications.
Formula:C8H16N2
InChI:InChI=1S/C8H16N2/c1-10-5-4-7-2-3-8(6-10)9-7/h7-9H,2-6H2,1H3
InChI key:InChIKey=NLRPLOMLCUJBET-UHFFFAOYSA-N
SMILES:CN1CC2NC(CC2)CC1
Synonyms:- 3,9-Diazabicyclo[4.2.1]nonane, 3-methyl-
- 3-Methyl-3,9-diazabicyclo[4.2.1]nonane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.