
CAS 108438-52-4
:2-Bromo-3-chloro-1H-indole
Description:
2-Bromo-3-chloro-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of bromine and chlorine substituents at the 2 and 3 positions, respectively, contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature. It may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing effects of the halogen substituents. Additionally, 2-Bromo-3-chloro-1H-indole can serve as a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals, owing to the indole moiety's significance in medicinal chemistry. Its unique combination of halogen atoms can also influence its biological activity, making it a subject of interest in research focused on drug development and material science. Safety precautions should be observed when handling this compound, as halogenated compounds can pose health risks and environmental concerns.
Formula:C8H5BrClN
InChI:InChI=1S/C8H5BrClN/c9-8-7(10)5-3-1-2-4-6(5)11-8/h1-4,11H
InChI key:InChIKey=VECCYQZDQOPISO-UHFFFAOYSA-N
SMILES:ClC=1C=2C(NC1Br)=CC=CC2
Synonyms:- 2-Bromo-3-chloro-1H-indole
- 1H-Indole, 2-bromo-3-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.