CymitQuimica logo

CAS 108446-72-6

:

3-[3-(4-FLUORO-PHENYL)-1-PHENYL-1H-PYRAZOL-4-YL]-ACRYLIC ACID

Description:
3-[3-(4-Fluoro-phenyl)-1-phenyl-1H-pyrazol-4-yl]-acrylic acid, with the CAS number 108446-72-6, is a chemical compound characterized by its unique structure that includes a pyrazole ring and an acrylic acid moiety. This compound features a 4-fluorophenyl group attached to the pyrazole, which contributes to its potential biological activity and chemical reactivity. The presence of the acrylic acid functional group suggests that it may participate in various chemical reactions, such as polymerization or esterification. The fluorine atom in the structure can enhance lipophilicity and influence the compound's interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential to modulate biological pathways. Additionally, its structural complexity may allow for diverse applications in organic synthesis and material science. As with many chemical substances, safety and handling precautions should be observed, given its potential reactivity and biological effects.
Formula:C18H13FN2O2
InChI:InChI=1/C18H13FN2O2/c19-15-9-6-13(7-10-15)18-14(8-11-17(22)23)12-21(20-18)16-4-2-1-3-5-16/h1-12H,(H,22,23)/b11-8+
Synonyms:
  • (2E)-3-[3-(4-fluorophenyl)-1-phenyl-1H-pyrazol-4-yl]prop-2-enoate
  • (2E)-3-[3-(4-fluorophenyl)-1-phenyl-1H-pyrazol-4-yl]prop-2-enoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.