
CAS 108461-05-8
:1-Cyclopropyl-6-fluoro-1,4-dihydro-7-(8-methyl-3,8-diazabicyclo[3.2.1]oct-3-yl)-4-oxo-3-quinolinecarboxylic acid
Description:
1-Cyclopropyl-6-fluoro-1,4-dihydro-7-(8-methyl-3,8-diazabicyclo[3.2.1]oct-3-yl)-4-oxo-3-quinolinecarboxylic acid, with CAS number 108461-05-8, is a synthetic organic compound characterized by its complex bicyclic structure and multiple functional groups. This compound features a quinoline backbone, which is known for its biological activity, particularly in medicinal chemistry. The presence of a cyclopropyl group and a fluorine atom contributes to its unique chemical reactivity and potential pharmacological properties. The 4-oxo and carboxylic acid functionalities suggest that it may exhibit acidic behavior and participate in hydrogen bonding, which can influence its solubility and interaction with biological targets. Additionally, the diazabicyclo structure may enhance its binding affinity to specific receptors or enzymes. Overall, this compound is of interest in drug development, particularly for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C20H22FN3O3
InChI:InChI=1S/C20H22FN3O3/c1-22-12-4-5-13(22)9-23(8-12)18-7-17-14(6-16(18)21)19(25)15(20(26)27)10-24(17)11-2-3-11/h6-7,10-13H,2-5,8-9H2,1H3,(H,26,27)
InChI key:InChIKey=ALRZZABRVIYCNY-UHFFFAOYSA-N
SMILES:O=C1C=2C(N(C=C1C(O)=O)C3CC3)=CC(=C(F)C2)N4CC5N(C)C(C4)CC5
Synonyms:- 1-Cyclopropyl-6-fluoro-1,4-dihydro-7-(8-methyl-3,8-diazabicyclo[3.2.1]oct-3-yl)-4-oxo-3-quinolinecarboxylic acid
- CP 74667
- 3-Quinolinecarboxylic acid, 1-cyclopropyl-6-fluoro-1,4-dihydro-7-(8-methyl-3,8-diazabicyclo[3.2.1]oct-3-yl)-4-oxo-
- 3,8-Diazabicyclo[3.2.1]octane, 3-quinolinecarboxylic acid deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CP 74667
CAS:<p>CP 74667 is a new fluoroquinolone that has good activity against several gram-positive and gram-negative pathogens.</p>Formula:C20H22FN3O3Color and Shape:SolidMolecular weight:371.41
