CAS 108462-96-0

N-(4-Methoxybenzoyl)alanine

Description:

N-(4-Methoxybenzoyl)alanine, with the CAS number 108462-96-0, is an organic compound that features both an amino acid and an aromatic moiety in its structure. It is characterized by the presence of an alanine residue, which is an α-amino acid, linked to a 4-methoxybenzoyl group. This compound typically exhibits properties associated with both amino acids and aromatic compounds, such as solubility in polar solvents and potential interactions with biological systems. The methoxy group on the benzoyl moiety can influence its reactivity and solubility, making it of interest in various chemical and biological applications. Additionally, the compound may exhibit specific biological activities, which could be relevant in pharmaceutical research or as a biochemical probe. Its structural features suggest potential for use in drug design, particularly in the development of compounds that target specific biological pathways or receptors. As with many organic compounds, its stability, reactivity, and interactions can be influenced by environmental conditions such as pH and temperature.

Formula: C₁₁H₁₃NO₄

InChI: InChI=1S/C11H13NO4/c1-7(11(14)15)12-10(13)8-3-5-9(16-2)6-4-8/h3-7H,1-2H3,(H,12,13)(H,14,15)

InChI key: InChIKey=RWJPONNMYFWDLB-UHFFFAOYSA-N

SMILES: C(NC(C(O)=O)C)(=O)C1=CC=C(OC)C=C1

Synonyms:

• 2-[(4-Methoxyphenyl)formamido]propanoic acid
• 2-(4-Methoxybenzamido)propanoic acid
• DL-Alanine, N-(4-methoxybenzoyl)-
• N-(4-Methoxybenzoyl)alanine
• Alanine, N-(4-methoxybenzoyl)-