CAS 108484-96-4
:N4,N4-Diethyl-4,6-pyrimidinediamine
Description:
N4,N4-Diethyl-4,6-pyrimidinediamine, with the CAS number 108484-96-4, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features two ethyl groups attached to the nitrogen atoms at the 4 position, contributing to its diethyl substitution. It is typically a solid at room temperature and may exhibit properties such as solubility in polar organic solvents due to the presence of the amine functional groups. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Its reactivity is influenced by the amine groups, which can participate in hydrogen bonding and nucleophilic reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H14N4
InChI:InChI=1S/C8H14N4/c1-3-12(4-2)8-5-7(9)10-6-11-8/h5-6H,3-4H2,1-2H3,(H2,9,10,11)
InChI key:InChIKey=LCFCHAHOFYUCCV-UHFFFAOYSA-N
SMILES:N(CC)(CC)C=1C=C(N)N=CN1
Synonyms:- 4,6-Pyrimidinediamine, N4,N4-diethyl-
- N4,N4-Diethyl-4,6-pyrimidinediamine
- Pyrimidine, 4-amino-6-diethylamino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.