CAS 1084896-41-2
:Phenylmethyl 4-cyano-4-deoxy-β-<span class="text-smallcaps">D</span>-arabinopyranoside
Description:
Phenylmethyl 4-cyano-4-deoxy-β-D-arabinopyranoside, identified by its CAS number 1084896-41-2, is a chemical compound characterized by its structural features that include a phenylmethyl group and a cyano functional group attached to a deoxy sugar moiety. This compound is a derivative of β-D-arabinopyranoside, which is a sugar that plays a role in various biological processes. The presence of the cyano group indicates potential reactivity, making it useful in synthetic organic chemistry. Its phenylmethyl group contributes to its hydrophobic character, influencing its solubility and interaction with biological membranes. The compound may exhibit specific biological activities, which can be of interest in medicinal chemistry and drug development. Additionally, its unique structure may allow for various modifications, leading to the exploration of its derivatives for enhanced properties or activities. Overall, this compound represents a blend of carbohydrate chemistry and functional group reactivity, making it a subject of interest in both academic and industrial research.
Formula:C13H15NO4
InChI:InChI=1S/C13H15NO4/c14-6-10-8-18-13(12(16)11(10)15)17-7-9-4-2-1-3-5-9/h1-5,10-13,15-16H,7-8H2/t10-,11-,12+,13-/m1/s1
InChI key:InChIKey=NOASZWPQLFNEJB-FVCCEPFGSA-N
SMILES:O(CC1=CC=CC=C1)[C@H]2[C@@H](O)[C@H](O)[C@H](C#N)CO2
Synonyms:- β-D-Arabinopyranoside, phenylmethyl 4-cyano-4-deoxy-
- Phenylmethyl 4-cyano-4-deoxy-β-D-arabinopyranoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.