CAS 108494-56-0

6-Fluoro-1-methyl-4(1H)-quinolinone

Description:

6-Fluoro-1-methyl-4(1H)-quinolinone is a synthetic organic compound characterized by its quinolinone structure, which features a fused bicyclic system containing both a benzene and a pyridine ring. The presence of a fluorine atom at the 6-position and a methyl group at the 1-position contributes to its unique chemical properties, including potential biological activity. This compound is often studied for its pharmacological applications, particularly in medicinal chemistry, due to its ability to interact with various biological targets. It may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects can vary based on the context of its use. The compound is typically characterized by its melting point, solubility in organic solvents, and spectral data, including NMR and mass spectrometry, which help confirm its structure. As with many quinolinone derivatives, it may also participate in various chemical reactions, making it a valuable intermediate in the synthesis of more complex molecules.

Formula: C₁₀H₈FNO

InChI: InChI=1S/C10H8FNO/c1-12-5-4-10(13)8-6-7(11)2-3-9(8)12/h2-6H,1H3

InChI key: InChIKey=RECXZBCRYVVAKV-UHFFFAOYSA-N

SMILES: O=C1C=2C(N(C)C=C1)=CC=C(F)C2

Synonyms:

• 4(1H)-Quinolinone, 6-fluoro-1-methyl-
• 6-Fluoro-1-methyl-4(1H)-quinolinone