
CAS 108494-79-7
:7-Chloro-6-fluoro-4-quinolinol
Description:
7-Chloro-6-fluoro-4-quinolinol, with the CAS number 108494-79-7, is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure that includes a nitrogen atom in the aromatic ring. This compound features a chloro group at the 7-position and a fluoro group at the 6-position, along with a hydroxyl group at the 4-position, which contributes to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogen substituents can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also exhibit antimicrobial or antiviral properties, although specific biological activities would depend on further empirical studies. As with many quinoline derivatives, it may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Proper handling and safety measures should be observed due to its potential toxicity and environmental impact.
Formula:C9H5ClFNO
InChI:InChI=1S/C9H5ClFNO/c10-6-4-8-5(3-7(6)11)9(13)1-2-12-8/h1-4H,(H,12,13)
InChI key:InChIKey=JVSXZJROLBGYID-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(Cl)C(F)=C2)N=CC1
Synonyms:- 7-Chloro-6-fluoro-4-quinolinol
- 4-Quinolinol, 7-chloro-6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.