CAS 108499-21-4

2,3-Dimethoxybenzenemethanethiol

Description:

2,3-Dimethoxybenzenemethanethiol, identified by its CAS number 108499-21-4, is an organic compound characterized by the presence of a thiol (-SH) functional group attached to a benzene ring that is further substituted with two methoxy (-OCH3) groups. This compound features a dimethoxybenzene structure, which contributes to its aromatic properties and potential reactivity. The presence of the thiol group imparts unique chemical characteristics, including the ability to form disulfide bonds and participate in nucleophilic reactions. 2,3-Dimethoxybenzenemethanethiol is likely to exhibit moderate solubility in organic solvents, while its polar thiol group may enhance its solubility in polar solvents. The compound may also display interesting biological activities, making it of interest in medicinal chemistry and materials science. Its synthesis typically involves the functionalization of a dimethoxybenzene precursor, followed by thiol addition. As with many thiols, it may have a characteristic odor and should be handled with care due to potential reactivity and toxicity.

Formula: C₉H₁₂O₂S

InChI: InChI=1S/C9H12O2S/c1-10-8-5-3-4-7(6-12)9(8)11-2/h3-5,12H,6H2,1-2H3

InChI key: InChIKey=DFGRWUULXOHCGW-UHFFFAOYSA-N

SMILES: O(C)C1=C(CS)C=CC=C1OC

Synonyms:

• (2,3-Dimethoxyphenyl)methanethiol
• Benzenemethanethiol, 2,3-dimethoxy-
• 2,3-Dimethoxybenzenemethanethiol