CAS 108499-33-8

Methyl (2-furanylmethyl)thioacetate

Description:

Methyl (2-furanylmethyl)thioacetate is an organic compound characterized by its unique structure, which includes a furan ring and a thioester functional group. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The presence of the furan moiety contributes to its potential reactivity, particularly in electrophilic aromatic substitution reactions. Methyl (2-furanylmethyl)thioacetate may exhibit biological activity, making it of interest in fields such as medicinal chemistry and fragrance formulation. Its thioacetate group can undergo hydrolysis to release the corresponding thiol and acetic acid, which may further participate in various chemical reactions. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, its unique structure and properties make it a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₈H₁₀O₃S

InChI: InChI=1/C8H10O3S/c1-10-8(9)6-12-5-7-3-2-4-11-7/h2-4H,5-6H2,1H3

SMILES: COC(=O)CSCc1ccco1

Synonyms:

• Methyl [(Furan-2-Ylmethyl)Sulfanyl]Acetate

2-[(2-Furanylmethyl)thio]-acetic Acid Methyl Ester

CAS: 108499-33-8

Formula: C₈H₁₀O₃S

Molecular weight: 186.2282

Ref: IN-DA003RIC

2-​[(2-​Furanylmethyl)​thio]​-acetic Acid Methyl Ester

Controlled Product

CAS: 108499-33-8

Formula: C₈H₁₀O₃S

Color and Shape: Neat

Molecular weight: 186.228

Ref: TR-F219500