CAS 108507-42-2
:(R)OCTAHYDRO-1H-INDOLE-2-CARBOXYLIC ACID
Description:
(R)Octahydro-1H-indole-2-carboxylic acid, with the CAS number 108507-42-2, is a bicyclic compound characterized by its unique structure that includes a saturated indole ring system. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity. The presence of the octahydro configuration indicates that the compound is fully saturated, lacking double bonds, which can influence its physical properties such as solubility and boiling point. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The stereochemistry denoted by the "(R)" prefix suggests that the compound has a specific three-dimensional arrangement of atoms, which can significantly affect its interactions with biological targets. Overall, (R)Octahydro-1H-indole-2-carboxylic acid is a compound of interest in organic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C9H15NO2
InChI:InChI=1/C9H15NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h6-8,10H,1-5H2,(H,11,12)/t6-,7-,8-/m1/s1
InChI key:InChIKey=CQYBNXGHMBNGCG-BWZBUEFSSA-N
SMILES:C(O)(=O)[C@H]1C[C@@]2([C@](N1)(CCCC2)[H])[H]
Synonyms:- (2R,3aR,7aR)-Octahydro-1H-indole-2-carboxylic acid
- (2R,3aR,7aR)-octahydro-1H-indolium-2-carboxylate
- 1H-Indole-2-carboxylic acid, octahydro-, (2R,3aR,7aR)-
- 1H-Indole-2-carboxylic acid, octahydro-, [2R-(2α,3aβ,7aβ)]-
- 1H-Indole-2-carboxylicacid,octahydro-,(2R,3aR,7aR)-(9CI)
- octahydro-1H-indole-2-carboxylic acid
- (R)OCTAHYDRO-1H-INDOLE-2-CARBOXYLIC ACID
- Perindopril Related Compound 6
- (2R)-octahydro-1H-indole-2-carboxylic acid
- (2R)-Octahydroindole-2-carboxylic acid
- (2R, 3aR,7aR)-Octahydro-indole-2-carboxylic acid
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
ent-Perindopril EP Impurity A (ent-Perindopril USP Related Compound A)
CAS:Formula:C9H15NO2Color and Shape:White To Off-White SolidMolecular weight:169.22

