CAS 108534-47-0
:4-(Tert-Butyldimethylsilyloxy)Phenol
Description:
4-(Tert-Butyldimethylsilyloxy)phenol, with the CAS number 108534-47-0, is an organic compound characterized by the presence of a phenolic hydroxyl group and a tert-butyldimethylsilyl ether functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its stability and resistance to hydrolysis, which makes it useful in various chemical applications, including as a protecting group in organic synthesis. The tert-butyldimethylsilyl group enhances the compound's lipophilicity, allowing it to dissolve in organic solvents while providing steric hindrance that can influence reactivity. Additionally, the phenolic part of the molecule contributes to its potential antioxidant properties. This compound is often utilized in the synthesis of more complex organic molecules and in materials science for its functional properties. Safety precautions should be taken when handling this substance, as with many organosilicon compounds, due to potential irritant effects.
Formula:C12H20O2Si
InChI:InChI=1/C12H20O2Si/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11/h6-9,13H,1-5H3
SMILES:CC(C)(C)[Si](C)(C)Oc1ccc(cc1)O
Synonyms:- 4-([tert-Butyl(dimethyl)silyl]oxy)phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(tert-Butyldimethylsiloxy)phenol
CAS:Formula:C12H20O2SiPurity:95%Color and Shape:SolidMolecular weight:224.37154-(tert-Butyldimethylsiloxy)phenol
CAS:4-(tert-Butyldimethylsiloxy)phenolPurity:98%Molecular weight:224.37g/mol4-(tert-Butyldimethylsiloxy)phenol
CAS:4-(TERT-BUTYLDIMETHYLSILYLOXY)PHENOL9& is a linker that can be used in the synthesis of polymers. The compound has been shown to form mesomorphic phases and lamellar phases, depending on the solvent used. It has also been shown to form supramolecular structures when combined with other polymers, such as polystyrene. 4-(TERT-BUTYLDIMETHYLSILYLOXY)PHENOL9& is a monomer that can be polymerized to form chemical structures such as poly(4-(TERT-BUTYLDIMETHYLSILYLOXY)PHENOL9&). This compound can be synthesized from commercially available materials through solid phase synthesis techniques.Formula:C12H20O2SiPurity:Min. 95%Molecular weight:224.37 g/mol



