CAS 108544-97-4
:5,6-Dichlorovanillic acid
Description:
5,6-Dichlorovanillic acid is an aromatic compound characterized by the presence of two chlorine atoms and a carboxylic acid group attached to a vanillin structure. It features a benzene ring with a methoxy group and a carboxylic acid functional group, contributing to its acidic properties. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of chlorine substituents enhances its reactivity and can influence its biological activity, making it of interest in various chemical and pharmaceutical applications. 5,6-Dichlorovanillic acid is often studied for its potential role in biochemical pathways, particularly in relation to plant physiology and herbicide development. Its molecular structure allows for interactions with various biological targets, which can lead to significant effects in plant growth regulation and metabolism. As with many chlorinated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C8H6Cl2O4
InChI:InChI=1/C8H6Cl2O4/c1-14-4-2-3(8(12)13)5(9)6(10)7(4)11/h2,11H,1H3,(H,12,13)
SMILES:COc1cc(c(c(c1O)Cl)Cl)C(=O)O
Synonyms:- 5,6-Dichloro-4-hydroxy-3-methoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5,6-Dichloro-4-hydroxy-3-methoxybenzoic acid
CAS:5,6-Dichloro-4-hydroxy-3-methoxybenzoic acidPurity:95%Molecular weight:237.04g/mol5,6-Dichlorovanillic acid
CAS:5,6-Dichlorovanillic acid is a high quality, versatile molecule that can be used as a reagent in organic synthesis or as a building block for the synthesis of complex compounds. It has many useful properties, such as being a fine chemical and research chemicals. 5,6-Dichlorovanillic acid is also a speciality chemical with versatile uses in building blocks or reaction components.
Formula:C8H6Cl2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:237.04 g/mol

