CAS 1085526-17-5

S-(2-Fluorophenyl)-S-methylsulfoximine

Description:

S-(2-Fluorophenyl)-S-methylsulfoximine is a chemical compound characterized by the presence of a sulfoximine functional group, which consists of a sulfur atom bonded to both an oxygen atom and a nitrogen atom, along with a methyl group and a 2-fluorophenyl substituent. This compound typically exhibits properties associated with sulfoximines, such as potential biological activity and the ability to act as a ligand in various chemical reactions. The presence of the fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity or selectivity in biological systems. S-(2-Fluorophenyl)-S-methylsulfoximine may also exhibit solubility in organic solvents, and its stability can be affected by environmental conditions such as temperature and pH. Due to its unique structure, this compound may be of interest in medicinal chemistry and agrochemical applications, where it could serve as a lead compound for the development of new pharmaceuticals or pesticides.

Formula: C₇H₈FNOS

InChI: InChI=1S/C7H8FNOS/c1-11(9,10)7-5-3-2-4-6(7)8/h2-5,9H,1H3

InChI key: InChIKey=UZVOTLOTIZBCCI-UHFFFAOYSA-N

SMILES: S(C)(=N)(=O)C1=C(F)C=CC=C1

Synonyms:

• (2-Fluorophenyl)(imino)(methyl)-λ6-sulfanone
• Sulfoximine, S-(2-fluorophenyl)-S-methyl-
• S-(2-Fluorophenyl)-S-methylsulfoximine

S-​(2-​Fluorophenyl)​-​S-​methyl-sulfoximine

CAS: 1085526-17-5

Versatile small molecule scaffold

Formula: C₇H₈FNOS

Purity: Min. 95%

Molecular weight: 173.21 g/mol

Ref: 3D-KTB52617