CAS 108554-34-3
:4-OXO-PIPERIDINE-3-CARBOXYLIC ACID METHYL ESTER
Description:
4-Oxo-piperidine-3-carboxylic acid methyl ester, with the CAS number 108554-34-3, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a ketone group (4-oxo) and a carboxylic acid moiety that is esterified with a methyl group, contributing to its reactivity and solubility properties. Typically, such compounds exhibit moderate polarity due to the presence of both hydrophobic (the piperidine ring) and hydrophilic (the carboxylate and ester groups) functional groups. They may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making them valuable in synthetic organic chemistry. Additionally, derivatives of piperidine are often explored for their biological activities, including potential pharmaceutical applications. The compound's stability, solubility in organic solvents, and reactivity can vary based on environmental conditions such as pH and temperature, which are important considerations in both laboratory and industrial settings.
Formula:C7H11NO3
InChI:InChI=1/C7H11NO3/c1-11-7(10)5-4-8-3-2-6(5)9/h5,8H,2-4H2,1H3
SMILES:COC(=O)C1CNCCC1=O
Synonyms:- 3-Carbomethoxy-4-Piperidone
- Methyl 4-Oxopiperidine-3-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
