CAS 108562-68-1

1-(2-amino-3-ethylphenyl)ethanol

Description:

1-(2-Amino-3-ethylphenyl)ethanol, with the CAS number 108562-68-1, is an organic compound characterized by the presence of an amino group and a hydroxyl group attached to a phenyl ring. This compound features a two-carbon ethyl side chain on the phenyl ring, contributing to its hydrophobic characteristics. The amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The hydroxyl group enhances its solubility in polar solvents and can engage in hydrogen bonding, making it a potential candidate for applications in pharmaceuticals and organic synthesis. The compound's structure suggests it may exhibit biological activity, possibly influencing neurotransmitter systems or acting as a precursor in the synthesis of more complex molecules. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 1-(2-amino-3-ethylphenyl)ethanol is a versatile compound with potential applications in medicinal chemistry and materials science.

Formula: C₁₀H₁₅NO

InChI: InChI=1/C10H15NO/c1-3-8-5-4-6-9(7(2)12)10(8)11/h4-7,12H,3,11H2,1-2H3

SMILES: CCc1cccc(C(C)O)c1N

2-(1-Hydroxyethyl)-6-ethylaniline

CAS: 108562-68-1

2-(1-Hydroxyethyl)-6-ethylaniline is an organic chemical compound, which is often utilized as an intermediate in the synthesis of dyes, pigments, and other industrial chemicals. This compound is derived from aromatic amines and undergoes specific chemical reactions that enable its functionality in various synthetic processes.

Formula: C₁₀H₁₅NO

Purity: Min. 95%

Molecular weight: 165.23 g/mol

Ref: 3D-IEA56268